C8H16FNO — CID 99994990
(2S,4S)-2-ethyl-4-(2-fluoroethoxy)pyrrolidine (PubChem CID 99994990) has the molecular formula C8H16FNO and a molecular weight of 161.22 g/mol. Its IUPAC name is (2S,4S)-2-ethyl-4-(2-fluoroethoxy)pyrrolidine.
| Compound Name | (2S,4S)-2-ethyl-4-(2-fluoroethoxy)pyrrolidine |
|---|---|
| PubChem CID | 99994990 |
| Molecular Formula | C8H16FNO |
| Molecular Weight | 161.22 g/mol |
| Exact Mass | 161.12 |
| IUPAC Name | (2S,4S)-2-ethyl-4-(2-fluoroethoxy)pyrrolidine |
| SMILES | CC[C@H]1C[C@H](OCCF)CN1 |
| InChI | InChI=1S/C8H16FNO/c1-2-7-5-8(6-10-7)11-4-3-9/h7-8,10H,2-6H2,1H3/t7-,8-/m0/s1 |
| InChIKey | BRRBGJQJLGQAHL-YUMQZZPRSA-N |
| XLogP | 1.11 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 161.22 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |