C12H19NO3 — CID 99995947
tert-butyl N-[(1S,4R,7S)-2-oxo-7-bicyclo[2.2.1]heptanyl]carbamate (PubChem CID 99995947) has the molecular formula C12H19NO3 and a molecular weight of 225.29 g/mol. Its IUPAC name is tert-butyl N-[(1S,4R,7S)-2-oxo-7-bicyclo[2.2.1]heptanyl]carbamate.
| Compound Name | tert-butyl N-[(1S,4R,7S)-2-oxo-7-bicyclo[2.2.1]heptanyl]carbamate |
|---|---|
| PubChem CID | 99995947 |
| Molecular Formula | C12H19NO3 |
| Molecular Weight | 225.29 g/mol |
| Exact Mass | 225.14 |
| IUPAC Name | tert-butyl N-[(1S,4R,7S)-2-oxo-7-bicyclo[2.2.1]heptanyl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@H]1[C@@H]2CC[C@@H]1C(=O)C2 |
| InChI | InChI=1S/C12H19NO3/c1-12(2,3)16-11(15)13-10-7-4-5-8(10)9(14)6-7/h7-8,10H,4-6H2,1-3H3,(H,13,15)/t7-,8-,10+/m1/s1 |
| InChIKey | RPUFVAFRGVIQJT-MRTMQBJTSA-N |
| XLogP | 1.88 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.29 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |