C10H16O2S2 — CID 99996193
methyl (3R)-6,10-dithiaspiro[4.5]decane-3-carboxylate (PubChem CID 99996193) has the molecular formula C10H16O2S2 and a molecular weight of 232.37 g/mol. Its IUPAC name is methyl (3R)-6,10-dithiaspiro[4.5]decane-3-carboxylate.
| Compound Name | methyl (3R)-6,10-dithiaspiro[4.5]decane-3-carboxylate |
|---|---|
| PubChem CID | 99996193 |
| Molecular Formula | C10H16O2S2 |
| Molecular Weight | 232.37 g/mol |
| Exact Mass | 232.06 |
| IUPAC Name | methyl (3R)-6,10-dithiaspiro[4.5]decane-3-carboxylate |
| SMILES | COC(=O)[C@@H]1CCC2(C1)SCCCS2 |
| InChI | InChI=1S/C10H16O2S2/c1-12-9(11)8-3-4-10(7-8)13-5-2-6-14-10/h8H,2-7H2,1H3/t8-/m1/s1 |
| InChIKey | NJMWRKWIKBDXKX-MRVPVSSYSA-N |
| XLogP | 2.53 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.37 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |