About methyl (2R)-7-amino-4-methyl-2,3-dihydro-1H-cyclopenta[b]indole-2-carboxylate
methyl (2R)-7-amino-4-methyl-2,3-dihydro-1H-cyclopenta[b]indole-2-carboxylate (PubChem CID 99996425) has the molecular formula C14H16N2O2
and a molecular weight of 244.29 g/mol. Its IUPAC name is methyl (2R)-7-amino-4-methyl-2,3-dihydro-1H-cyclopenta[b]indole-2-carboxylate.
Molecular Properties
| Compound Name | methyl (2R)-7-amino-4-methyl-2,3-dihydro-1H-cyclopenta[b]indole-2-carboxylate |
| PubChem CID | 99996425 |
| Molecular Formula | C14H16N2O2 |
| Molecular Weight | 244.29 g/mol |
| Exact Mass | 244.12 |
| IUPAC Name | methyl (2R)-7-amino-4-methyl-2,3-dihydro-1H-cyclopenta[b]indole-2-carboxylate |
| SMILES | COC(=O)[C@@H]1Cc2c(n(C)c3ccc(N)cc23)C1 |
| InChI | InChI=1S/C14H16N2O2/c1-16-12-4-3-9(15)7-11(12)10-5-8(6-13(10)16)14(17)18-2/h3-4,7-8H,5-6,15H2,1-2H3/t8-/m1/s1 |
| InChIKey | MVXGWUIXWKPHEQ-MRVPVSSYSA-N |
| XLogP | 1.65 |
| TPSA | 57.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.29 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze methyl (2R)-7-amino-4-methyl-2,3-dihydro-1H-cyclopenta[b]indole-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (2R)-7-amino-4-methyl-2,3-dihydro-1H-cyclopenta[b]indole-2-carboxylate?
The IUPAC name of methyl (2R)-7-amino-4-methyl-2,3-dihydro-1H-cyclopenta[b]indole-2-carboxylate (CID 99996425) is methyl (2R)-7-amino-4-methyl-2,3-dihydro-1H-cyclopenta[b]indole-2-carboxylate.
What is the SMILES notation for methyl (2R)-7-amino-4-methyl-2,3-dihydro-1H-cyclopenta[b]indole-2-carboxylate?
The canonical SMILES for methyl (2R)-7-amino-4-methyl-2,3-dihydro-1H-cyclopenta[b]indole-2-carboxylate is COC(=O)[C@@H]1Cc2c(n(C)c3ccc(N)cc23)C1.
What is the InChIKey of methyl (2R)-7-amino-4-methyl-2,3-dihydro-1H-cyclopenta[b]indole-2-carboxylate?
The InChIKey is MVXGWUIXWKPHEQ-MRVPVSSYSA-N. The full InChI is InChI=1S/C14H16N2O2/c1-16-12-4-3-9(15)7-11(12)10-5-8(6-13(10)16)14(17)18-2/h3-4,7-8H,5-6,15H2,1-2H3/t8-/m1/s1.
What are the key properties of methyl (2R)-7-amino-4-methyl-2,3-dihydro-1H-cyclopenta[b]indole-2-carboxylate?
methyl (2R)-7-amino-4-methyl-2,3-dihydro-1H-cyclopenta[b]indole-2-carboxylate has a molecular weight of 244.29 g/mol, XLogP of 1.65, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (2R)-7-amino-4-methyl-2,3-dihydro-1H-cyclopenta[b]indole-2-carboxylate is sourced from PubChem (CID 99996425), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).