About (2R)-7-amino-4-methyl-2,3-dihydro-1H-cyclopenta[b]indole-2-carboxylic acid
(2R)-7-amino-4-methyl-2,3-dihydro-1H-cyclopenta[b]indole-2-carboxylic acid (PubChem CID 99996433) has the molecular formula C13H14N2O2
and a molecular weight of 230.27 g/mol. Its IUPAC name is (2R)-7-amino-4-methyl-2,3-dihydro-1H-cyclopenta[b]indole-2-carboxylic acid.
Molecular Properties
| Compound Name | (2R)-7-amino-4-methyl-2,3-dihydro-1H-cyclopenta[b]indole-2-carboxylic acid |
| PubChem CID | 99996433 |
| Molecular Formula | C13H14N2O2 |
| Molecular Weight | 230.27 g/mol |
| Exact Mass | 230.11 |
| IUPAC Name | (2R)-7-amino-4-methyl-2,3-dihydro-1H-cyclopenta[b]indole-2-carboxylic acid |
| SMILES | Cn1c2c(c3cc(N)ccc31)C[C@@H](C(=O)O)C2 |
| InChI | InChI=1S/C13H14N2O2/c1-15-11-3-2-8(14)6-10(11)9-4-7(13(16)17)5-12(9)15/h2-3,6-7H,4-5,14H2,1H3,(H,16,17)/t7-/m1/s1 |
| InChIKey | UGGZJHPAJYJIQI-SSDOTTSWSA-N |
| XLogP | 1.56 |
| TPSA | 68.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.27 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze (2R)-7-amino-4-methyl-2,3-dihydro-1H-cyclopenta[b]indole-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-7-amino-4-methyl-2,3-dihydro-1H-cyclopenta[b]indole-2-carboxylic acid?
The IUPAC name of (2R)-7-amino-4-methyl-2,3-dihydro-1H-cyclopenta[b]indole-2-carboxylic acid (CID 99996433) is (2R)-7-amino-4-methyl-2,3-dihydro-1H-cyclopenta[b]indole-2-carboxylic acid.
What is the SMILES notation for (2R)-7-amino-4-methyl-2,3-dihydro-1H-cyclopenta[b]indole-2-carboxylic acid?
The canonical SMILES for (2R)-7-amino-4-methyl-2,3-dihydro-1H-cyclopenta[b]indole-2-carboxylic acid is Cn1c2c(c3cc(N)ccc31)C[C@@H](C(=O)O)C2.
What is the InChIKey of (2R)-7-amino-4-methyl-2,3-dihydro-1H-cyclopenta[b]indole-2-carboxylic acid?
The InChIKey is UGGZJHPAJYJIQI-SSDOTTSWSA-N. The full InChI is InChI=1S/C13H14N2O2/c1-15-11-3-2-8(14)6-10(11)9-4-7(13(16)17)5-12(9)15/h2-3,6-7H,4-5,14H2,1H3,(H,16,17)/t7-/m1/s1.
What are the key properties of (2R)-7-amino-4-methyl-2,3-dihydro-1H-cyclopenta[b]indole-2-carboxylic acid?
(2R)-7-amino-4-methyl-2,3-dihydro-1H-cyclopenta[b]indole-2-carboxylic acid has a molecular weight of 230.27 g/mol, XLogP of 1.56, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-7-amino-4-methyl-2,3-dihydro-1H-cyclopenta[b]indole-2-carboxylic acid is sourced from PubChem (CID 99996433), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).