C13H13NO — CID 99996452
[(2R)-2,3-dihydro-1H-cyclopenta[b]quinolin-2-yl]methanol (PubChem CID 99996452) has the molecular formula C13H13NO and a molecular weight of 199.25 g/mol. Its IUPAC name is [(2R)-2,3-dihydro-1H-cyclopenta[b]quinolin-2-yl]methanol.
| Compound Name | [(2R)-2,3-dihydro-1H-cyclopenta[b]quinolin-2-yl]methanol |
|---|---|
| PubChem CID | 99996452 |
| Molecular Formula | C13H13NO |
| Molecular Weight | 199.25 g/mol |
| Exact Mass | 199.10 |
| IUPAC Name | [(2R)-2,3-dihydro-1H-cyclopenta[b]quinolin-2-yl]methanol |
| SMILES | OC[C@@H]1Cc2cc3ccccc3nc2C1 |
| InChI | InChI=1S/C13H13NO/c15-8-9-5-11-7-10-3-1-2-4-12(10)14-13(11)6-9/h1-4,7,9,15H,5-6,8H2/t9-/m1/s1 |
| InChIKey | JINHQGDMTCXPHB-SECBINFHSA-N |
| XLogP | 1.94 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.25 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |