C18H17N3O3 — CID 99996532
1-(furan-2-yl)-2-[(2R)-2-(6-methyl-1H-benzimidazol-2-yl)pyrrolidin-1-yl]ethane-1,2-dione (PubChem CID 99996532) has the molecular formula C18H17N3O3 and a molecular weight of 323.35 g/mol. Its IUPAC name is 1-(furan-2-yl)-2-[(2R)-2-(6-methyl-1H-benzimidazol-2-yl)pyrrolidin-1-yl]ethane-1,2-dione.
| Compound Name | 1-(furan-2-yl)-2-[(2R)-2-(6-methyl-1H-benzimidazol-2-yl)pyrrolidin-1-yl]ethane-1,2-dione |
|---|---|
| PubChem CID | 99996532 |
| Molecular Formula | C18H17N3O3 |
| Molecular Weight | 323.35 g/mol |
| Exact Mass | 323.13 |
| IUPAC Name | 1-(furan-2-yl)-2-[(2R)-2-(6-methyl-1H-benzimidazol-2-yl)pyrrolidin-1-yl]ethane-1,2-dione |
| SMILES | Cc1ccc2nc([C@H]3CCCN3C(=O)C(=O)c3ccco3)[nH]c2c1 |
| InChI | InChI=1S/C18H17N3O3/c1-11-6-7-12-13(10-11)20-17(19-12)14-4-2-8-21(14)18(23)16(22)15-5-3-9-24-15/h3,5-7,9-10,14H,2,4,8H2,1H3,(H,19,20)/t14-/m1/s1 |
| InChIKey | ZPOHTGPSFBKJDG-CQSZACIVSA-N |
| XLogP | 3.01 |
| TPSA | 79.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.35 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|