C24H22O6 — CID 99998888
(10S)-10-(1,3-benzodioxol-5-yl)spiro[9,10-dihydro-3H-pyrano[2,3-f]chromene-2,1'-cyclohexane]-4,8-dione (PubChem CID 99998888) has the molecular formula C24H22O6 and a molecular weight of 406.43 g/mol. Its IUPAC name is (10S)-10-(1,3-benzodioxol-5-yl)spiro[9,10-dihydro-3H-pyrano[2,3-f]chromene-2,1'-cyclohexane]-4,8-dione.
| Compound Name | (10S)-10-(1,3-benzodioxol-5-yl)spiro[9,10-dihydro-3H-pyrano[2,3-f]chromene-2,1'-cyclohexane]-4,8-dione |
|---|---|
| PubChem CID | 99998888 |
| Molecular Formula | C24H22O6 |
| Molecular Weight | 406.43 g/mol |
| Exact Mass | 406.14 |
| IUPAC Name | (10S)-10-(1,3-benzodioxol-5-yl)spiro[9,10-dihydro-3H-pyrano[2,3-f]chromene-2,1'-cyclohexane]-4,8-dione |
| SMILES | O=C1C[C@@H](c2ccc3c(c2)OCO3)c2c(ccc3c2OC2(CCCCC2)CC3=O)O1 |
| InChI | InChI=1S/C24H22O6/c25-17-12-24(8-2-1-3-9-24)30-23-15(17)5-7-19-22(23)16(11-21(26)29-19)14-4-6-18-20(10-14)28-13-27-18/h4-7,10,16H,1-3,8-9,11-13H2/t16-/m0/s1 |
| InChIKey | PTBJCDHDGPTNSW-INIZCTEOSA-N |
| XLogP | 4.52 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.43 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|