C20H23N3O3 — CID 99998905
(4R)-1-(furan-2-ylmethyl)-4-[(2S)-2-pyridin-3-ylpiperidine-1-carbonyl]pyrrolidin-2-one (PubChem CID 99998905) has the molecular formula C20H23N3O3 and a molecular weight of 353.42 g/mol. Its IUPAC name is (4R)-1-(furan-2-ylmethyl)-4-[(2S)-2-pyridin-3-ylpiperidine-1-carbonyl]pyrrolidin-2-one.
| Compound Name | (4R)-1-(furan-2-ylmethyl)-4-[(2S)-2-pyridin-3-ylpiperidine-1-carbonyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 99998905 |
| Molecular Formula | C20H23N3O3 |
| Molecular Weight | 353.42 g/mol |
| Exact Mass | 353.17 |
| IUPAC Name | (4R)-1-(furan-2-ylmethyl)-4-[(2S)-2-pyridin-3-ylpiperidine-1-carbonyl]pyrrolidin-2-one |
| SMILES | O=C1C[C@@H](C(=O)N2CCCC[C@H]2c2cccnc2)CN1Cc1ccco1 |
| InChI | InChI=1S/C20H23N3O3/c24-19-11-16(13-22(19)14-17-6-4-10-26-17)20(25)23-9-2-1-7-18(23)15-5-3-8-21-12-15/h3-6,8,10,12,16,18H,1-2,7,9,11,13-14H2/t16-,18+/m1/s1 |
| InChIKey | QYEREGIDYOOQHV-AEFFLSMTSA-N |
| XLogP | 2.78 |
| TPSA | 66.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.42 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |