About cis-ethyl (1S,2R)-2-(benzenesulfonyl)-1-cyanocyclopropane-1-carboxylate
cis-ethyl (1S,2R)-2-(benzenesulfonyl)-1-cyanocyclopropane-1-carboxylate (PubChem CID 99998952) has the molecular formula C13H13NO4S
and a molecular weight of 279.32 g/mol. Its IUPAC name is cis-ethyl (1S,2R)-2-(benzenesulfonyl)-1-cyanocyclopropane-1-carboxylate.
Molecular Properties
| Compound Name | cis-ethyl (1S,2R)-2-(benzenesulfonyl)-1-cyanocyclopropane-1-carboxylate |
| PubChem CID | 99998952 |
| Molecular Formula | C13H13NO4S |
| Molecular Weight | 279.32 g/mol |
| Exact Mass | 279.06 |
| IUPAC Name | cis-ethyl (1S,2R)-2-(benzenesulfonyl)-1-cyanocyclopropane-1-carboxylate |
| SMILES | CCOC(=O)[C@@]1(C#N)C[C@H]1S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C13H13NO4S/c1-2-18-12(15)13(9-14)8-11(13)19(16,17)10-6-4-3-5-7-10/h3-7,11H,2,8H2,1H3/t11-,13-/m1/s1 |
| InChIKey | UDLJNBRUSOUZER-DGCLKSJQSA-N |
| XLogP | 1.31 |
| TPSA | 84.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.32 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze cis-ethyl (1S,2R)-2-(benzenesulfonyl)-1-cyanocyclopropane-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cis-ethyl (1S,2R)-2-(benzenesulfonyl)-1-cyanocyclopropane-1-carboxylate?
The IUPAC name of cis-ethyl (1S,2R)-2-(benzenesulfonyl)-1-cyanocyclopropane-1-carboxylate (CID 99998952) is cis-ethyl (1S,2R)-2-(benzenesulfonyl)-1-cyanocyclopropane-1-carboxylate.
What is the SMILES notation for cis-ethyl (1S,2R)-2-(benzenesulfonyl)-1-cyanocyclopropane-1-carboxylate?
The canonical SMILES for cis-ethyl (1S,2R)-2-(benzenesulfonyl)-1-cyanocyclopropane-1-carboxylate is CCOC(=O)[C@@]1(C#N)C[C@H]1S(=O)(=O)c1ccccc1.
What is the InChIKey of cis-ethyl (1S,2R)-2-(benzenesulfonyl)-1-cyanocyclopropane-1-carboxylate?
The InChIKey is UDLJNBRUSOUZER-DGCLKSJQSA-N. The full InChI is InChI=1S/C13H13NO4S/c1-2-18-12(15)13(9-14)8-11(13)19(16,17)10-6-4-3-5-7-10/h3-7,11H,2,8H2,1H3/t11-,13-/m1/s1.
What are the key properties of cis-ethyl (1S,2R)-2-(benzenesulfonyl)-1-cyanocyclopropane-1-carboxylate?
cis-ethyl (1S,2R)-2-(benzenesulfonyl)-1-cyanocyclopropane-1-carboxylate has a molecular weight of 279.32 g/mol, XLogP of 1.31, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for cis-ethyl (1S,2R)-2-(benzenesulfonyl)-1-cyanocyclopropane-1-carboxylate is sourced from PubChem (CID 99998952), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).