C10H10O8 — CID 636372
View drug profile → aceglatone[(3R,3aS,6S,6aS)-6-acetyloxy-2,5-dioxo-3,3a,6,6a-tetrahydrofuro[3,2-b]furan-3-yl] acetate (PubChem CID 636372) has the molecular formula C10H10O8 and a molecular weight of 258.18 g/mol. Its IUPAC name is [(3R,3aS,6S,6aS)-6-acetyloxy-2,5-dioxo-3,3a,6,6a-tetrahydrofuro[3,2-b]furan-3-yl] acetate.
| Compound Name | [(3R,3aS,6S,6aS)-6-acetyloxy-2,5-dioxo-3,3a,6,6a-tetrahydrofuro[3,2-b]furan-3-yl] acetate |
|---|---|
| PubChem CID | 636372 |
| Molecular Formula | C10H10O8 |
| Molecular Weight | 258.18 g/mol |
| Exact Mass | 258.04 |
| IUPAC Name | [(3R,3aS,6S,6aS)-6-acetyloxy-2,5-dioxo-3,3a,6,6a-tetrahydrofuro[3,2-b]furan-3-yl] acetate |
| SMILES | CC(=O)O[C@@H]1C(=O)O[C@H]2[C@@H]1OC(=O)[C@@H]2OC(C)=O |
| InChI | InChI=1S/C10H10O8/c1-3(11)15-7-5-6(18-9(7)13)8(10(14)17-5)16-4(2)12/h5-8H,1-2H3/t5-,6-,7-,8+/m0/s1 |
| InChIKey | ZOZKYEHVNDEUCO-DKXJUACHSA-N |
| XLogP | -1.30 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.18 |
| LogP ≤ 5 | -1.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|