C21H19NO3S — CID 24145
View drug profile → alkofanone3-(4-aminophenyl)sulfonyl-1,3-diphenylpropan-1-one (PubChem CID 24145) has the molecular formula C21H19NO3S and a molecular weight of 365.45 g/mol. Its IUPAC name is 3-(4-aminophenyl)sulfonyl-1,3-diphenylpropan-1-one.
| Compound Name | 3-(4-aminophenyl)sulfonyl-1,3-diphenylpropan-1-one |
|---|---|
| PubChem CID | 24145 |
| Molecular Formula | C21H19NO3S |
| Molecular Weight | 365.45 g/mol |
| Exact Mass | 365.11 |
| IUPAC Name | 3-(4-aminophenyl)sulfonyl-1,3-diphenylpropan-1-one |
| SMILES | Nc1ccc(S(=O)(=O)C(CC(=O)c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C21H19NO3S/c22-18-11-13-19(14-12-18)26(24,25)21(17-9-5-2-6-10-17)15-20(23)16-7-3-1-4-8-16/h1-14,21H,15,22H2 |
| InChIKey | VWEMSUCCUQSLME-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 77.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.45 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|