C9H9N3S — CID 10275
View drug profile → amiphenazole5-phenyl-1,3-thiazole-2,4-diamine (PubChem CID 10275) has the molecular formula C9H9N3S and a molecular weight of 191.26 g/mol. Its IUPAC name is 5-phenyl-1,3-thiazole-2,4-diamine.
| Compound Name | 5-phenyl-1,3-thiazole-2,4-diamine |
|---|---|
| PubChem CID | 10275 |
| Molecular Formula | C9H9N3S |
| Molecular Weight | 191.26 g/mol |
| Exact Mass | 191.05 |
| IUPAC Name | 5-phenyl-1,3-thiazole-2,4-diamine |
| SMILES | Nc1nc(N)c(-c2ccccc2)s1 |
| InChI | InChI=1S/C9H9N3S/c10-8-7(13-9(11)12-8)6-4-2-1-3-5-6/h1-5H,10H2,(H2,11,12) |
| InChIKey | UPOYFZYFGWBUKL-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 64.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.26 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |