C12H11ClN6O2S2 — CID 2273
View drug profile → azosemide2-chloro-5-(2H-tetrazol-5-yl)-4-(thiophen-2-ylmethylamino)benzenesulfonamide (PubChem CID 2273) has the molecular formula C12H11ClN6O2S2 and a molecular weight of 370.85 g/mol. Its IUPAC name is 2-chloro-5-(2H-tetrazol-5-yl)-4-(thiophen-2-ylmethylamino)benzenesulfonamide.
| Compound Name | 2-chloro-5-(2H-tetrazol-5-yl)-4-(thiophen-2-ylmethylamino)benzenesulfonamide |
|---|---|
| PubChem CID | 2273 |
| Molecular Formula | C12H11ClN6O2S2 |
| Molecular Weight | 370.85 g/mol |
| Exact Mass | 370.01 |
| IUPAC Name | 2-chloro-5-(2H-tetrazol-5-yl)-4-(thiophen-2-ylmethylamino)benzenesulfonamide |
| SMILES | NS(=O)(=O)c1cc(-c2nn[nH]n2)c(NCc2cccs2)cc1Cl |
| InChI | InChI=1S/C12H11ClN6O2S2/c13-9-5-10(15-6-7-2-1-3-22-7)8(12-16-18-19-17-12)4-11(9)23(14,20)21/h1-5,15H,6H2,(H2,14,20,21)(H,16,17,18,19) |
| InChIKey | HMEDEBAJARCKCT-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 126.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.85 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |