C14H22BrN3O2 — CID 2446
View drug profile → bromopride4-amino-5-bromo-N-[2-(diethylamino)ethyl]-2-methoxybenzamide (PubChem CID 2446) has the molecular formula C14H22BrN3O2 and a molecular weight of 344.25 g/mol. Its IUPAC name is 4-amino-5-bromo-N-[2-(diethylamino)ethyl]-2-methoxybenzamide.
| Compound Name | 4-amino-5-bromo-N-[2-(diethylamino)ethyl]-2-methoxybenzamide |
|---|---|
| PubChem CID | 2446 |
| Molecular Formula | C14H22BrN3O2 |
| Molecular Weight | 344.25 g/mol |
| Exact Mass | 343.09 |
| IUPAC Name | 4-amino-5-bromo-N-[2-(diethylamino)ethyl]-2-methoxybenzamide |
| SMILES | CCN(CC)CCNC(=O)c1cc(Br)c(N)cc1OC |
| InChI | InChI=1S/C14H22BrN3O2/c1-4-18(5-2)7-6-17-14(19)10-8-11(15)12(16)9-13(10)20-3/h8-9H,4-7,16H2,1-3H3,(H,17,19) |
| InChIKey | GIYAQDDTCWHPPL-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.25 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|