About 3-(dibutylamino)propyl 4-aminobenzoate
3-(dibutylamino)propyl 4-aminobenzoate (PubChem CID 2480) has the molecular formula C18H30N2O2
and a molecular weight of 306.45 g/mol. Its IUPAC name is 3-(dibutylamino)propyl 4-aminobenzoate.
Molecular Properties
| Compound Name | 3-(dibutylamino)propyl 4-aminobenzoate |
| PubChem CID | 2480 |
| Molecular Formula | C18H30N2O2 |
| Molecular Weight | 306.45 g/mol |
| Exact Mass | 306.23 |
| IUPAC Name | 3-(dibutylamino)propyl 4-aminobenzoate |
| SMILES | CCCCN(CCCC)CCCOC(=O)c1ccc(N)cc1 |
| InChI | InChI=1S/C18H30N2O2/c1-3-5-12-20(13-6-4-2)14-7-15-22-18(21)16-8-10-17(19)11-9-16/h8-11H,3-7,12-15,19H2,1-2H3 |
| InChIKey | HQFWVSGBVLEQGA-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 306.45 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 3-(dibutylamino)propyl 4-aminobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(dibutylamino)propyl 4-aminobenzoate?
The IUPAC name of 3-(dibutylamino)propyl 4-aminobenzoate (CID 2480) is 3-(dibutylamino)propyl 4-aminobenzoate.
What is the SMILES notation for 3-(dibutylamino)propyl 4-aminobenzoate?
The canonical SMILES for 3-(dibutylamino)propyl 4-aminobenzoate is CCCCN(CCCC)CCCOC(=O)c1ccc(N)cc1.
What is the InChIKey of 3-(dibutylamino)propyl 4-aminobenzoate?
The InChIKey is HQFWVSGBVLEQGA-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H30N2O2/c1-3-5-12-20(13-6-4-2)14-7-15-22-18(21)16-8-10-17(19)11-9-16/h8-11H,3-7,12-15,19H2,1-2H3.
What are the key properties of 3-(dibutylamino)propyl 4-aminobenzoate?
3-(dibutylamino)propyl 4-aminobenzoate has a molecular weight of 306.45 g/mol, XLogP of 3.72, 11 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(dibutylamino)propyl 4-aminobenzoate is sourced from PubChem (CID 2480), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).