C6H10N4O3S2 — CID 519309
View drug profile → butazolamideN-(5-sulfamoyl-1,3,4-thiadiazol-2-yl)butanamide (PubChem CID 519309) has the molecular formula C6H10N4O3S2 and a molecular weight of 250.30 g/mol. Its IUPAC name is N-(5-sulfamoyl-1,3,4-thiadiazol-2-yl)butanamide.
| Compound Name | N-(5-sulfamoyl-1,3,4-thiadiazol-2-yl)butanamide |
|---|---|
| PubChem CID | 519309 |
| Molecular Formula | C6H10N4O3S2 |
| Molecular Weight | 250.30 g/mol |
| Exact Mass | 250.02 |
| IUPAC Name | N-(5-sulfamoyl-1,3,4-thiadiazol-2-yl)butanamide |
| SMILES | CCCC(=O)Nc1nnc(S(N)(=O)=O)s1 |
| InChI | InChI=1S/C6H10N4O3S2/c1-2-3-4(11)8-5-9-10-6(14-5)15(7,12)13/h2-3H2,1H3,(H2,7,12,13)(H,8,9,11) |
| InChIKey | HZIYHIRJHYIRQO-UHFFFAOYSA-N |
| XLogP | -0.08 |
| TPSA | 115.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.30 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|