About (4-benzylphenyl) carbamate
(4-benzylphenyl) carbamate (PubChem CID 7572) has the molecular formula C14H13NO2
and a molecular weight of 227.26 g/mol. Its IUPAC name is (4-benzylphenyl) carbamate.
Molecular Properties
| Compound Name | (4-benzylphenyl) carbamate |
| PubChem CID | 7572 |
| Molecular Formula | C14H13NO2 |
| Molecular Weight | 227.26 g/mol |
| Exact Mass | 227.09 |
| IUPAC Name | (4-benzylphenyl) carbamate |
| SMILES | NC(=O)Oc1ccc(Cc2ccccc2)cc1 |
| InChI | InChI=1S/C14H13NO2/c15-14(16)17-13-8-6-12(7-9-13)10-11-4-2-1-3-5-11/h1-9H,10H2,(H2,15,16) |
| InChIKey | ZBJBRUSGEJORQL-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.26 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (4-benzylphenyl) carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-benzylphenyl) carbamate?
The IUPAC name of (4-benzylphenyl) carbamate (CID 7572) is (4-benzylphenyl) carbamate.
What is the SMILES notation for (4-benzylphenyl) carbamate?
The canonical SMILES for (4-benzylphenyl) carbamate is NC(=O)Oc1ccc(Cc2ccccc2)cc1.
What is the InChIKey of (4-benzylphenyl) carbamate?
The InChIKey is ZBJBRUSGEJORQL-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H13NO2/c15-14(16)17-13-8-6-12(7-9-13)10-11-4-2-1-3-5-11/h1-9H,10H2,(H2,15,16).
What are the key properties of (4-benzylphenyl) carbamate?
(4-benzylphenyl) carbamate has a molecular weight of 227.26 g/mol, XLogP of 2.73, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4-benzylphenyl) carbamate is sourced from PubChem (CID 7572), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).