C5H9Cl2N3O2 — CID 2578
View drug profile → carmustine1,3-bis(2-chloroethyl)-1-nitrosourea (PubChem CID 2578) has the molecular formula C5H9Cl2N3O2 and a molecular weight of 214.05 g/mol. Its IUPAC name is 1,3-bis(2-chloroethyl)-1-nitrosourea.
| Compound Name | 1,3-bis(2-chloroethyl)-1-nitrosourea |
|---|---|
| PubChem CID | 2578 |
| Molecular Formula | C5H9Cl2N3O2 |
| Molecular Weight | 214.05 g/mol |
| Exact Mass | 213.01 |
| IUPAC Name | 1,3-bis(2-chloroethyl)-1-nitrosourea |
| SMILES | O=NN(CCCl)C(=O)NCCCl |
| InChI | InChI=1S/C5H9Cl2N3O2/c6-1-3-8-5(11)10(9-12)4-2-7/h1-4H2,(H,8,11) |
| InChIKey | DLGOEMSEDOSKAD-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 61.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.05 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|