C10H10ClN5O2 — CID 11962412
View drug profile → cenobamate[(1R)-1-(2-chlorophenyl)-2-(tetrazol-2-yl)ethyl] carbamate (PubChem CID 11962412) has the molecular formula C10H10ClN5O2 and a molecular weight of 267.68 g/mol. Its IUPAC name is [(1R)-1-(2-chlorophenyl)-2-(tetrazol-2-yl)ethyl] carbamate.
| Compound Name | [(1R)-1-(2-chlorophenyl)-2-(tetrazol-2-yl)ethyl] carbamate |
|---|---|
| PubChem CID | 11962412 |
| Molecular Formula | C10H10ClN5O2 |
| Molecular Weight | 267.68 g/mol |
| Exact Mass | 267.05 |
| IUPAC Name | [(1R)-1-(2-chlorophenyl)-2-(tetrazol-2-yl)ethyl] carbamate |
| SMILES | NC(=O)O[C@@H](Cn1ncnn1)c1ccccc1Cl |
| InChI | InChI=1S/C10H10ClN5O2/c11-8-4-2-1-3-7(8)9(18-10(12)17)5-16-14-6-13-15-16/h1-4,6,9H,5H2,(H2,12,17)/t9-/m0/s1 |
| InChIKey | GFHAXPJGXSQLPT-VIFPVBQESA-N |
| XLogP | 1.16 |
| TPSA | 95.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.68 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |