C11H11Cl4NO2 — CID 7330
View drug profile → chlorbetamide2,2-dichloro-N-[(2,4-dichlorophenyl)methyl]-N-(2-hydroxyethyl)acetamide (PubChem CID 7330) has the molecular formula C11H11Cl4NO2 and a molecular weight of 331.03 g/mol. Its IUPAC name is 2,2-dichloro-N-[(2,4-dichlorophenyl)methyl]-N-(2-hydroxyethyl)acetamide.
| Compound Name | 2,2-dichloro-N-[(2,4-dichlorophenyl)methyl]-N-(2-hydroxyethyl)acetamide |
|---|---|
| PubChem CID | 7330 |
| Molecular Formula | C11H11Cl4NO2 |
| Molecular Weight | 331.03 g/mol |
| Exact Mass | 328.95 |
| IUPAC Name | 2,2-dichloro-N-[(2,4-dichlorophenyl)methyl]-N-(2-hydroxyethyl)acetamide |
| SMILES | O=C(C(Cl)Cl)N(CCO)Cc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C11H11Cl4NO2/c12-8-2-1-7(9(13)5-8)6-16(3-4-17)11(18)10(14)15/h1-2,5,10,17H,3-4,6H2 |
| InChIKey | STLZCUYBVPNYED-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.03 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|