C11H17Cl3N2O2S — CID 21782
View drug profile → clodantoin5-heptan-3-yl-3-(trichloromethylsulfanyl)imidazolidine-2,4-dione (PubChem CID 21782) has the molecular formula C11H17Cl3N2O2S and a molecular weight of 347.70 g/mol. Its IUPAC name is 5-heptan-3-yl-3-(trichloromethylsulfanyl)imidazolidine-2,4-dione.
| Compound Name | 5-heptan-3-yl-3-(trichloromethylsulfanyl)imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 21782 |
| Molecular Formula | C11H17Cl3N2O2S |
| Molecular Weight | 347.70 g/mol |
| Exact Mass | 346.01 |
| IUPAC Name | 5-heptan-3-yl-3-(trichloromethylsulfanyl)imidazolidine-2,4-dione |
| SMILES | CCCCC(CC)C1NC(=O)N(SC(Cl)(Cl)Cl)C1=O |
| InChI | InChI=1S/C11H17Cl3N2O2S/c1-3-5-6-7(4-2)8-9(17)16(10(18)15-8)19-11(12,13)14/h7-8H,3-6H2,1-2H3,(H,15,18) |
| InChIKey | VOGJJBHRUDVEFM-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.70 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|