C12H13I3N2O3 — CID 27648
View drug profile → iocetamic acid3-(N-acetyl-3-amino-2,4,6-triiodoanilino)-2-methylpropanoic acid (PubChem CID 27648) has the molecular formula C12H13I3N2O3 and a molecular weight of 613.96 g/mol. Its IUPAC name is 3-(N-acetyl-3-amino-2,4,6-triiodoanilino)-2-methylpropanoic acid.
| Compound Name | 3-(N-acetyl-3-amino-2,4,6-triiodoanilino)-2-methylpropanoic acid |
|---|---|
| PubChem CID | 27648 |
| Molecular Formula | C12H13I3N2O3 |
| Molecular Weight | 613.96 g/mol |
| Exact Mass | 613.81 |
| IUPAC Name | 3-(N-acetyl-3-amino-2,4,6-triiodoanilino)-2-methylpropanoic acid |
| SMILES | CC(=O)N(CC(C)C(=O)O)c1c(I)cc(I)c(N)c1I |
| InChI | InChI=1S/C12H13I3N2O3/c1-5(12(19)20)4-17(6(2)18)11-8(14)3-7(13)10(16)9(11)15/h3,5H,4,16H2,1-2H3,(H,19,20) |
| InChIKey | GSVQIUGOUKJHRC-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 83.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.96 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|