C27H22Cl2N4 — CID 2794
View drug profile → clofazimineN,5-bis(4-chlorophenyl)-3-propan-2-yliminophenazin-2-amine (PubChem CID 2794) has the molecular formula C27H22Cl2N4 and a molecular weight of 473.41 g/mol. Its IUPAC name is N,5-bis(4-chlorophenyl)-3-propan-2-yliminophenazin-2-amine.
| Compound Name | N,5-bis(4-chlorophenyl)-3-propan-2-yliminophenazin-2-amine |
|---|---|
| PubChem CID | 2794 |
| Molecular Formula | C27H22Cl2N4 |
| Molecular Weight | 473.41 g/mol |
| Exact Mass | 472.12 |
| IUPAC Name | N,5-bis(4-chlorophenyl)-3-propan-2-yliminophenazin-2-amine |
| SMILES | CC(C)/N=c1\cc2n(-c3ccc(Cl)cc3)c3ccccc3nc-2cc1Nc1ccc(Cl)cc1 |
| InChI | InChI=1S/C27H22Cl2N4/c1-17(2)30-24-16-27-25(15-23(24)31-20-11-7-18(28)8-12-20)32-22-5-3-4-6-26(22)33(27)21-13-9-19(29)10-14-21/h3-17,31H,1-2H3/b30-24+ |
| InChIKey | WDQPAMHFFCXSNU-BGABXYSRSA-N |
| XLogP | 7.49 |
| TPSA | 42.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.41 |
| LogP ≤ 5 | 7.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|