About copper ethanimidate
copper ethanimidate (PubChem CID 159106233) has the molecular formula C4H8CuN2O2
and a molecular weight of 179.67 g/mol. Its IUPAC name is copper ethanimidate.
Molecular Properties
| Compound Name | copper ethanimidate |
| PubChem CID | 159106233 |
| Molecular Formula | C4H8CuN2O2 |
| Molecular Weight | 179.67 g/mol |
| Exact Mass | 178.99 |
| IUPAC Name | copper ethanimidate |
| SMILES | [Cu+2].[H]/N=C(\C)[O-].[H]/N=C(\C)[O-] |
| InChI | InChI=1S/2C2H5NO.Cu/c2*1-2(3)4;/h2*1H3,(H2,3,4);/q;;+2/p-2 |
| InChIKey | KDXPTTBEEGFREG-UHFFFAOYSA-L |
| XLogP | -1.31 |
| TPSA | 93.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.67 |
| LogP ≤ 5 | -1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze copper ethanimidate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of copper ethanimidate?
The IUPAC name of copper ethanimidate (CID 159106233) is copper ethanimidate.
What is the SMILES notation for copper ethanimidate?
The canonical SMILES for copper ethanimidate is [Cu+2].[H]/N=C(\C)[O-].[H]/N=C(\C)[O-].
What is the InChIKey of copper ethanimidate?
The InChIKey is KDXPTTBEEGFREG-UHFFFAOYSA-L. The full InChI is InChI=1S/2C2H5NO.Cu/c2*1-2(3)4;/h2*1H3,(H2,3,4);/q;;+2/p-2.
What are the key properties of copper ethanimidate?
copper ethanimidate has a molecular weight of 179.67 g/mol, XLogP of -1.31, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for copper ethanimidate is sourced from PubChem (CID 159106233), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).