C12H22N2O2 — CID 5368010
View drug profile → crotetamide2-[[(E)-but-2-enoyl]-ethylamino]-N,N-dimethylbutanamide (PubChem CID 5368010) has the molecular formula C12H22N2O2 and a molecular weight of 226.32 g/mol. Its IUPAC name is 2-[[(E)-but-2-enoyl]-ethylamino]-N,N-dimethylbutanamide.
| Compound Name | 2-[[(E)-but-2-enoyl]-ethylamino]-N,N-dimethylbutanamide |
|---|---|
| PubChem CID | 5368010 |
| Molecular Formula | C12H22N2O2 |
| Molecular Weight | 226.32 g/mol |
| Exact Mass | 226.17 |
| IUPAC Name | 2-[[(E)-but-2-enoyl]-ethylamino]-N,N-dimethylbutanamide |
| SMILES | C/C=C/C(=O)N(CC)C(CC)C(=O)N(C)C |
| InChI | InChI=1S/C12H22N2O2/c1-6-9-11(15)14(8-3)10(7-2)12(16)13(4)5/h6,9-10H,7-8H2,1-5H3/b9-6+ |
| InChIKey | LSAMUAYPDHUBQD-RMKNXTFCSA-N |
| XLogP | 1.28 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.32 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|