About decyl acetate
decyl acetate (PubChem CID 8167) has the molecular formula C12H24O2
and a molecular weight of 200.32 g/mol. Its IUPAC name is decyl acetate.
Molecular Properties
| Compound Name | decyl acetate |
| PubChem CID | 8167 |
| Molecular Formula | C12H24O2 |
| Molecular Weight | 200.32 g/mol |
| Exact Mass | 200.18 |
| IUPAC Name | decyl acetate |
| SMILES | CCCCCCCCCCOC(C)=O |
| InChI | InChI=1S/C12H24O2/c1-3-4-5-6-7-8-9-10-11-14-12(2)13/h3-11H2,1-2H3 |
| InChIKey | NUPSHWCALHZGOV-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.32 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze decyl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of decyl acetate?
The IUPAC name of decyl acetate (CID 8167) is decyl acetate.
What is the SMILES notation for decyl acetate?
The canonical SMILES for decyl acetate is CCCCCCCCCCOC(C)=O.
What is the InChIKey of decyl acetate?
The InChIKey is NUPSHWCALHZGOV-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H24O2/c1-3-4-5-6-7-8-9-10-11-14-12(2)13/h3-11H2,1-2H3.
What are the key properties of decyl acetate?
decyl acetate has a molecular weight of 200.32 g/mol, XLogP of 3.69, 9 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for decyl acetate is sourced from PubChem (CID 8167), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).