C19H12O8 — CID 26248
View drug profile → diacerein4,5-diacetyloxy-9,10-dioxoanthracene-2-carboxylic acid (PubChem CID 26248) has the molecular formula C19H12O8 and a molecular weight of 368.30 g/mol. Its IUPAC name is 4,5-diacetyloxy-9,10-dioxoanthracene-2-carboxylic acid.
| Compound Name | 4,5-diacetyloxy-9,10-dioxoanthracene-2-carboxylic acid |
|---|---|
| PubChem CID | 26248 |
| Molecular Formula | C19H12O8 |
| Molecular Weight | 368.30 g/mol |
| Exact Mass | 368.05 |
| IUPAC Name | 4,5-diacetyloxy-9,10-dioxoanthracene-2-carboxylic acid |
| SMILES | CC(=O)Oc1cccc2c1C(=O)c1c(OC(C)=O)cc(C(=O)O)cc1C2=O |
| InChI | InChI=1S/C19H12O8/c1-8(20)26-13-5-3-4-11-15(13)18(23)16-12(17(11)22)6-10(19(24)25)7-14(16)27-9(2)21/h3-7H,1-2H3,(H,24,25) |
| InChIKey | TYNLGDBUJLVSMA-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 124.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.30 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|