About dibenzofuran
dibenzofuran (PubChem CID 568) has the molecular formula C12H8O
and a molecular weight of 168.19 g/mol. Its IUPAC name is dibenzofuran.
Molecular Properties
| Compound Name | dibenzofuran |
| PubChem CID | 568 |
| Molecular Formula | C12H8O |
| Molecular Weight | 168.19 g/mol |
| Exact Mass | 168.06 |
| IUPAC Name | dibenzofuran |
| SMILES | c1ccc2c(c1)oc1ccccc12 |
| InChI | InChI=1S/C12H8O/c1-3-7-11-9(5-1)10-6-2-4-8-12(10)13-11/h1-8H |
| InChIKey | TXCDCPKCNAJMEE-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.19 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze dibenzofuran with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dibenzofuran?
The IUPAC name of dibenzofuran (CID 568) is dibenzofuran.
What is the SMILES notation for dibenzofuran?
The canonical SMILES for dibenzofuran is c1ccc2c(c1)oc1ccccc12.
What is the InChIKey of dibenzofuran?
The InChIKey is TXCDCPKCNAJMEE-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H8O/c1-3-7-11-9(5-1)10-6-2-4-8-12(10)13-11/h1-8H.
What are the key properties of dibenzofuran?
dibenzofuran has a molecular weight of 168.19 g/mol, XLogP of 3.59, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for dibenzofuran is sourced from PubChem (CID 568), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).