C15H23N3OS — CID 8708
View drug profile → dimazole6-[2-(diethylamino)ethoxy]-N,N-dimethyl-1,3-benzothiazol-2-amine (PubChem CID 8708) has the molecular formula C15H23N3OS and a molecular weight of 293.44 g/mol. Its IUPAC name is 6-[2-(diethylamino)ethoxy]-N,N-dimethyl-1,3-benzothiazol-2-amine.
| Compound Name | 6-[2-(diethylamino)ethoxy]-N,N-dimethyl-1,3-benzothiazol-2-amine |
|---|---|
| PubChem CID | 8708 |
| Molecular Formula | C15H23N3OS |
| Molecular Weight | 293.44 g/mol |
| Exact Mass | 293.16 |
| IUPAC Name | 6-[2-(diethylamino)ethoxy]-N,N-dimethyl-1,3-benzothiazol-2-amine |
| SMILES | CCN(CC)CCOc1ccc2nc(N(C)C)sc2c1 |
| InChI | InChI=1S/C15H23N3OS/c1-5-18(6-2)9-10-19-12-7-8-13-14(11-12)20-15(16-13)17(3)4/h7-8,11H,5-6,9-10H2,1-4H3 |
| InChIKey | WGMYEOIMVYADRJ-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 28.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.44 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |