C15H15ClN2O4S — CID 26618
View drug profile → xipamide4-chloro-N-(2,6-dimethylphenyl)-2-hydroxy-5-sulfamoylbenzamide (PubChem CID 26618) has the molecular formula C15H15ClN2O4S and a molecular weight of 354.82 g/mol. Its IUPAC name is 4-chloro-N-(2,6-dimethylphenyl)-2-hydroxy-5-sulfamoylbenzamide.
| Compound Name | 4-chloro-N-(2,6-dimethylphenyl)-2-hydroxy-5-sulfamoylbenzamide |
|---|---|
| PubChem CID | 26618 |
| Molecular Formula | C15H15ClN2O4S |
| Molecular Weight | 354.82 g/mol |
| Exact Mass | 354.04 |
| IUPAC Name | 4-chloro-N-(2,6-dimethylphenyl)-2-hydroxy-5-sulfamoylbenzamide |
| SMILES | Cc1cccc(C)c1NC(=O)c1cc(S(N)(=O)=O)c(Cl)cc1O |
| InChI | InChI=1S/C15H15ClN2O4S/c1-8-4-3-5-9(2)14(8)18-15(20)10-6-13(23(17,21)22)11(16)7-12(10)19/h3-7,19H,1-2H3,(H,18,20)(H2,17,21,22) |
| InChIKey | MTZBBNMLMNBNJL-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 109.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.82 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |