C6H12Br2O4 — CID 5284380
View drug profile → mitolactol(2R,3S,4R,5S)-1,6-dibromohexane-2,3,4,5-tetrol (PubChem CID 5284380) has the molecular formula C6H12Br2O4 and a molecular weight of 307.97 g/mol. Its IUPAC name is (2R,3S,4R,5S)-1,6-dibromohexane-2,3,4,5-tetrol.
| Compound Name | (2R,3S,4R,5S)-1,6-dibromohexane-2,3,4,5-tetrol |
|---|---|
| PubChem CID | 5284380 |
| Molecular Formula | C6H12Br2O4 |
| Molecular Weight | 307.97 g/mol |
| Exact Mass | 305.91 |
| IUPAC Name | (2R,3S,4R,5S)-1,6-dibromohexane-2,3,4,5-tetrol |
| SMILES | O[C@H]([C@H](O)[C@@H](O)CBr)[C@H](O)CBr |
| InChI | InChI=1S/C6H12Br2O4/c7-1-3(9)5(11)6(12)4(10)2-8/h3-6,9-12H,1-2H2/t3-,4+,5+,6- |
| InChIKey | VFKZTMPDYBFSTM-GUCUJZIJSA-N |
| XLogP | -0.78 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.97 |
| LogP ≤ 5 | -0.78 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|