C24H29NO4 — CID 3280
View drug profile → ethaverine1-[(3,4-diethoxyphenyl)methyl]-6,7-diethoxyisoquinoline (PubChem CID 3280) has the molecular formula C24H29NO4 and a molecular weight of 395.50 g/mol. Its IUPAC name is 1-[(3,4-diethoxyphenyl)methyl]-6,7-diethoxyisoquinoline.
| Compound Name | 1-[(3,4-diethoxyphenyl)methyl]-6,7-diethoxyisoquinoline |
|---|---|
| PubChem CID | 3280 |
| Molecular Formula | C24H29NO4 |
| Molecular Weight | 395.50 g/mol |
| Exact Mass | 395.21 |
| IUPAC Name | 1-[(3,4-diethoxyphenyl)methyl]-6,7-diethoxyisoquinoline |
| SMILES | CCOc1ccc(Cc2nccc3cc(OCC)c(OCC)cc23)cc1OCC |
| InChI | InChI=1S/C24H29NO4/c1-5-26-21-10-9-17(14-22(21)27-6-2)13-20-19-16-24(29-8-4)23(28-7-3)15-18(19)11-12-25-20/h9-12,14-16H,5-8,13H2,1-4H3 |
| InChIKey | ZOWYFYXTIWQBEP-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 49.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.50 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |