C17H12ClNO2S — CID 28871
View drug profile → fentiazac2-[4-(4-chlorophenyl)-2-phenyl-1,3-thiazol-5-yl]acetic acid (PubChem CID 28871) has the molecular formula C17H12ClNO2S and a molecular weight of 329.81 g/mol. Its IUPAC name is 2-[4-(4-chlorophenyl)-2-phenyl-1,3-thiazol-5-yl]acetic acid.
| Compound Name | 2-[4-(4-chlorophenyl)-2-phenyl-1,3-thiazol-5-yl]acetic acid |
|---|---|
| PubChem CID | 28871 |
| Molecular Formula | C17H12ClNO2S |
| Molecular Weight | 329.81 g/mol |
| Exact Mass | 329.03 |
| IUPAC Name | 2-[4-(4-chlorophenyl)-2-phenyl-1,3-thiazol-5-yl]acetic acid |
| SMILES | O=C(O)Cc1sc(-c2ccccc2)nc1-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C17H12ClNO2S/c18-13-8-6-11(7-9-13)16-14(10-15(20)21)22-17(19-16)12-4-2-1-3-5-12/h1-9H,10H2,(H,20,21) |
| InChIKey | JIEKMACRVQTPRC-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.81 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |