C8H6F3N3O4S2 — CID 8992
View drug profile → flumethiazide1,1-dioxo-6-(trifluoromethyl)-4H-1lambda6,2,4-benzothiadiazine-7-sulfonamide (PubChem CID 8992) has the molecular formula C8H6F3N3O4S2 and a molecular weight of 329.28 g/mol. Its IUPAC name is 1,1-dioxo-6-(trifluoromethyl)-4H-1lambda6,2,4-benzothiadiazine-7-sulfonamide.
| Compound Name | 1,1-dioxo-6-(trifluoromethyl)-4H-1lambda6,2,4-benzothiadiazine-7-sulfonamide |
|---|---|
| PubChem CID | 8992 |
| Molecular Formula | C8H6F3N3O4S2 |
| Molecular Weight | 329.28 g/mol |
| Exact Mass | 328.98 |
| IUPAC Name | 1,1-dioxo-6-(trifluoromethyl)-4H-1lambda6,2,4-benzothiadiazine-7-sulfonamide |
| SMILES | NS(=O)(=O)c1cc2c(cc1C(F)(F)F)NC=NS2(=O)=O |
| InChI | InChI=1S/C8H6F3N3O4S2/c9-8(10,11)4-1-5-7(2-6(4)19(12,15)16)20(17,18)14-3-13-5/h1-3H,(H,13,14)(H2,12,15,16) |
| InChIKey | RGUQWGXAYZNLMI-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 118.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.28 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |