C9H7N5O3 — CID 6436102
View drug profile → furalazine6-[(E)-2-(5-nitrofuran-2-yl)ethenyl]-1,2,4-triazin-3-amine (PubChem CID 6436102) has the molecular formula C9H7N5O3 and a molecular weight of 233.19 g/mol. Its IUPAC name is 6-[(E)-2-(5-nitrofuran-2-yl)ethenyl]-1,2,4-triazin-3-amine.
| Compound Name | 6-[(E)-2-(5-nitrofuran-2-yl)ethenyl]-1,2,4-triazin-3-amine |
|---|---|
| PubChem CID | 6436102 |
| Molecular Formula | C9H7N5O3 |
| Molecular Weight | 233.19 g/mol |
| Exact Mass | 233.05 |
| IUPAC Name | 6-[(E)-2-(5-nitrofuran-2-yl)ethenyl]-1,2,4-triazin-3-amine |
| SMILES | Nc1ncc(/C=C/c2ccc([N+](=O)[O-])o2)nn1 |
| InChI | InChI=1S/C9H7N5O3/c10-9-11-5-6(12-13-9)1-2-7-3-4-8(17-7)14(15)16/h1-5H,(H2,10,11,13)/b2-1+ |
| InChIKey | RWOLIGKRDWLZSV-OWOJBTEDSA-N |
| XLogP | 1.13 |
| TPSA | 120.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.19 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|