C12H15N3O2S2 — CID 3489
View drug profile → glybuzoleN-(5-tert-butyl-1,3,4-thiadiazol-2-yl)benzenesulfonamide (PubChem CID 3489) has the molecular formula C12H15N3O2S2 and a molecular weight of 297.40 g/mol. Its IUPAC name is N-(5-tert-butyl-1,3,4-thiadiazol-2-yl)benzenesulfonamide.
| Compound Name | N-(5-tert-butyl-1,3,4-thiadiazol-2-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 3489 |
| Molecular Formula | C12H15N3O2S2 |
| Molecular Weight | 297.40 g/mol |
| Exact Mass | 297.06 |
| IUPAC Name | N-(5-tert-butyl-1,3,4-thiadiazol-2-yl)benzenesulfonamide |
| SMILES | CC(C)(C)c1nnc(NS(=O)(=O)c2ccccc2)s1 |
| InChI | InChI=1S/C12H15N3O2S2/c1-12(2,3)10-13-14-11(18-10)15-19(16,17)9-7-5-4-6-8-9/h4-8H,1-3H3,(H,14,15) |
| InChIKey | NMWQEPCLNXHPDX-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 71.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.40 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |