About heptalen-1-ol
heptalen-1-ol (PubChem CID 57470832) has the molecular formula C12H10O
and a molecular weight of 170.21 g/mol. Its IUPAC name is heptalen-1-ol.
Molecular Properties
| Compound Name | heptalen-1-ol |
| PubChem CID | 57470832 |
| Molecular Formula | C12H10O |
| Molecular Weight | 170.21 g/mol |
| Exact Mass | 170.07 |
| IUPAC Name | heptalen-1-ol |
| SMILES | OC1=CC=CC=C2C=CC=CC=C12 |
| InChI | InChI=1S/C12H10O/c13-12-9-5-4-7-10-6-2-1-3-8-11(10)12/h1-9,13H |
| InChIKey | XEVURMSGKLOULL-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.21 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze heptalen-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of heptalen-1-ol?
The IUPAC name of heptalen-1-ol (CID 57470832) is heptalen-1-ol.
What is the SMILES notation for heptalen-1-ol?
The canonical SMILES for heptalen-1-ol is OC1=CC=CC=C2C=CC=CC=C12.
What is the InChIKey of heptalen-1-ol?
The InChIKey is XEVURMSGKLOULL-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10O/c13-12-9-5-4-7-10-6-2-1-3-8-11(10)12/h1-9,13H.
What are the key properties of heptalen-1-ol?
heptalen-1-ol has a molecular weight of 170.21 g/mol, XLogP of 2.98, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for heptalen-1-ol is sourced from PubChem (CID 57470832), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).