C21H45N3 — CID 3607
View drug profile → hexetidine1,3-bis(2-ethylhexyl)-5-methyl-1,3-diazinan-5-amine (PubChem CID 3607) has the molecular formula C21H45N3 and a molecular weight of 339.61 g/mol. Its IUPAC name is 1,3-bis(2-ethylhexyl)-5-methyl-1,3-diazinan-5-amine.
| Compound Name | 1,3-bis(2-ethylhexyl)-5-methyl-1,3-diazinan-5-amine |
|---|---|
| PubChem CID | 3607 |
| Molecular Formula | C21H45N3 |
| Molecular Weight | 339.61 g/mol |
| Exact Mass | 339.36 |
| IUPAC Name | 1,3-bis(2-ethylhexyl)-5-methyl-1,3-diazinan-5-amine |
| SMILES | CCCCC(CC)CN1CN(CC(CC)CCCC)CC(C)(N)C1 |
| InChI | InChI=1S/C21H45N3/c1-6-10-12-19(8-3)14-23-16-21(5,22)17-24(18-23)15-20(9-4)13-11-7-2/h19-20H,6-18,22H2,1-5H3 |
| InChIKey | DTOUUUZOYKYHEP-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 32.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.61 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |