About hydroxyurea
hydroxyurea (PubChem CID 3657) has the molecular formula CH4N2O2
and a molecular weight of 76.05 g/mol. Its IUPAC name is hydroxyurea.
Molecular Properties
| Compound Name | hydroxyurea |
| PubChem CID | 3657 |
| Molecular Formula | CH4N2O2 |
| Molecular Weight | 76.05 g/mol |
| Exact Mass | 76.03 |
| IUPAC Name | hydroxyurea |
| SMILES | NC(=O)NO |
| InChI | InChI=1S/CH4N2O2/c2-1(4)3-5/h5H,(H3,2,3,4) |
| InChIKey | VSNHCAURESNICA-UHFFFAOYSA-N |
| XLogP | -0.96 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 5 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 76.05 |
| LogP ≤ 5 | -0.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze hydroxyurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hydroxyurea?
The IUPAC name of hydroxyurea (CID 3657) is hydroxyurea.
What is the SMILES notation for hydroxyurea?
The canonical SMILES for hydroxyurea is NC(=O)NO.
What is the InChIKey of hydroxyurea?
The InChIKey is VSNHCAURESNICA-UHFFFAOYSA-N. The full InChI is InChI=1S/CH4N2O2/c2-1(4)3-5/h5H,(H3,2,3,4).
What are the key properties of hydroxyurea?
hydroxyurea has a molecular weight of 76.05 g/mol, XLogP of -0.96, 0 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for hydroxyurea is sourced from PubChem (CID 3657), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).