C9H23NO7P2 — CID 146015366
View drug profile → ibandronic acidhydroxy-[3-[methyl(pentyl)amino]-1-oxonio-1-phosphonopropyl]phosphinate (PubChem CID 146015366) has the molecular formula C9H23NO7P2 and a molecular weight of 319.23 g/mol. Its IUPAC name is hydroxy-[3-[methyl(pentyl)amino]-1-oxonio-1-phosphonopropyl]phosphinate.
| Compound Name | hydroxy-[3-[methyl(pentyl)amino]-1-oxonio-1-phosphonopropyl]phosphinate |
|---|---|
| PubChem CID | 146015366 |
| Molecular Formula | C9H23NO7P2 |
| Molecular Weight | 319.23 g/mol |
| Exact Mass | 319.09 |
| IUPAC Name | hydroxy-[3-[methyl(pentyl)amino]-1-oxonio-1-phosphonopropyl]phosphinate |
| SMILES | CCCCCN(C)CCC([OH2+])(P(=O)([O-])O)P(=O)(O)O |
| InChI | InChI=1S/C9H23NO7P2/c1-3-4-5-7-10(2)8-6-9(11,18(12,13)14)19(15,16)17/h11H,3-8H2,1-2H3,(H2,12,13,14)(H2,15,16,17) |
| InChIKey | MPBVHIBUJCELCL-UHFFFAOYSA-N |
| XLogP | -0.40 |
| TPSA | 144.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.23 |
| LogP ≤ 5 | -0.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|