About icosanamide
icosanamide (PubChem CID 3016647) has the molecular formula C20H41NO
and a molecular weight of 311.55 g/mol. Its IUPAC name is icosanamide.
Molecular Properties
| Compound Name | icosanamide |
| PubChem CID | 3016647 |
| Molecular Formula | C20H41NO |
| Molecular Weight | 311.55 g/mol |
| Exact Mass | 311.32 |
| IUPAC Name | icosanamide |
| SMILES | CCCCCCCCCCCCCCCCCCCC(N)=O |
| InChI | InChI=1S/C20H41NO/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20(21)22/h2-19H2,1H3,(H2,21,22) |
| InChIKey | OOCSVLHOTKHEFZ-UHFFFAOYSA-N |
| XLogP | 6.51 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 311.55 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze icosanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of icosanamide?
The IUPAC name of icosanamide (CID 3016647) is icosanamide.
What is the SMILES notation for icosanamide?
The canonical SMILES for icosanamide is CCCCCCCCCCCCCCCCCCCC(N)=O.
What is the InChIKey of icosanamide?
The InChIKey is OOCSVLHOTKHEFZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H41NO/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20(21)22/h2-19H2,1H3,(H2,21,22).
What are the key properties of icosanamide?
icosanamide has a molecular weight of 311.55 g/mol, XLogP of 6.51, 18 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for icosanamide is sourced from PubChem (CID 3016647), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).