C17H22I3N3O8 — CID 3731
View drug profile → iomeprol1-N,3-N-bis(2,3-dihydroxypropyl)-5-[(2-hydroxyacetyl)-methylamino]-2,4,6-triiodobenzene-1,3-dicarboxamide (PubChem CID 3731) has the molecular formula C17H22I3N3O8 and a molecular weight of 777.09 g/mol. Its IUPAC name is 1-N,3-N-bis(2,3-dihydroxypropyl)-5-[(2-hydroxyacetyl)-methylamino]-2,4,6-triiodobenzene-1,3-dicarboxamide.
| Compound Name | 1-N,3-N-bis(2,3-dihydroxypropyl)-5-[(2-hydroxyacetyl)-methylamino]-2,4,6-triiodobenzene-1,3-dicarboxamide |
|---|---|
| PubChem CID | 3731 |
| Molecular Formula | C17H22I3N3O8 |
| Molecular Weight | 777.09 g/mol |
| Exact Mass | 776.85 |
| IUPAC Name | 1-N,3-N-bis(2,3-dihydroxypropyl)-5-[(2-hydroxyacetyl)-methylamino]-2,4,6-triiodobenzene-1,3-dicarboxamide |
| SMILES | CN(C(=O)CO)c1c(I)c(C(=O)NCC(O)CO)c(I)c(C(=O)NCC(O)CO)c1I |
| InChI | InChI=1S/C17H22I3N3O8/c1-23(9(29)6-26)15-13(19)10(16(30)21-2-7(27)4-24)12(18)11(14(15)20)17(31)22-3-8(28)5-25/h7-8,24-28H,2-6H2,1H3,(H,21,30)(H,22,31) |
| InChIKey | NJKDOADNQSYQEV-UHFFFAOYSA-N |
| XLogP | -1.38 |
| TPSA | 179.66 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 777.09 |
| LogP ≤ 5 | -1.38 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|