C4H11N5 — CID 4091
View drug profile → metformin3-(diaminomethylidene)-1,1-dimethylguanidine (PubChem CID 4091) has the molecular formula C4H11N5 and a molecular weight of 129.17 g/mol. Its IUPAC name is 3-(diaminomethylidene)-1,1-dimethylguanidine.
| Compound Name | 3-(diaminomethylidene)-1,1-dimethylguanidine |
|---|---|
| PubChem CID | 4091 |
| Molecular Formula | C4H11N5 |
| Molecular Weight | 129.17 g/mol |
| Exact Mass | 129.10 |
| IUPAC Name | 3-(diaminomethylidene)-1,1-dimethylguanidine |
| SMILES | [H]/N=C(/N=C(N)N)N(C)C |
| InChI | InChI=1S/C4H11N5/c1-9(2)4(7)8-3(5)6/h1-2H3,(H5,5,6,7,8) |
| InChIKey | XZWYZXLIPXDOLR-UHFFFAOYSA-N |
| XLogP | -1.24 |
| TPSA | 91.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 129.17 |
| LogP ≤ 5 | -1.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|