C11H14ClN — CID 11658860
View drug profile → lorcaserin(5R)-7-chloro-5-methyl-2,3,4,5-tetrahydro-1H-3-benzazepine (PubChem CID 11658860) has the molecular formula C11H14ClN and a molecular weight of 195.69 g/mol. Its IUPAC name is (5R)-7-chloro-5-methyl-2,3,4,5-tetrahydro-1H-3-benzazepine.
| Compound Name | (5R)-7-chloro-5-methyl-2,3,4,5-tetrahydro-1H-3-benzazepine |
|---|---|
| PubChem CID | 11658860 |
| Molecular Formula | C11H14ClN |
| Molecular Weight | 195.69 g/mol |
| Exact Mass | 195.08 |
| IUPAC Name | (5R)-7-chloro-5-methyl-2,3,4,5-tetrahydro-1H-3-benzazepine |
| SMILES | C[C@H]1CNCCc2ccc(Cl)cc21 |
| InChI | InChI=1S/C11H14ClN/c1-8-7-13-5-4-9-2-3-10(12)6-11(8)9/h2-3,6,8,13H,4-5,7H2,1H3/t8-/m0/s1 |
| InChIKey | XTTZERNUQAFMOF-QMMMGPOBSA-N |
| XLogP | 2.59 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.69 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |