About 6-methyl-1,1-dioxo-3,4-dihydro-2H-thiochromene-7-sulfonamide
6-methyl-1,1-dioxo-3,4-dihydro-2H-thiochromene-7-sulfonamide (PubChem CID 4165) has the molecular formula C10H13NO4S2
and a molecular weight of 275.35 g/mol. Its IUPAC name is 6-methyl-1,1-dioxo-3,4-dihydro-2H-thiochromene-7-sulfonamide.
Molecular Properties
| Compound Name | 6-methyl-1,1-dioxo-3,4-dihydro-2H-thiochromene-7-sulfonamide |
| PubChem CID | 4165 |
| Molecular Formula | C10H13NO4S2 |
| Molecular Weight | 275.35 g/mol |
| Exact Mass | 275.03 |
| IUPAC Name | 6-methyl-1,1-dioxo-3,4-dihydro-2H-thiochromene-7-sulfonamide |
| SMILES | Cc1cc2c(cc1S(N)(=O)=O)S(=O)(=O)CCC2 |
| InChI | InChI=1S/C10H13NO4S2/c1-7-5-8-3-2-4-16(12,13)10(8)6-9(7)17(11,14)15/h5-6H,2-4H2,1H3,(H2,11,14,15) |
| InChIKey | FNQQBFNIYODEMB-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 94.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.35 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-methyl-1,1-dioxo-3,4-dihydro-2H-thiochromene-7-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methyl-1,1-dioxo-3,4-dihydro-2H-thiochromene-7-sulfonamide?
The IUPAC name of 6-methyl-1,1-dioxo-3,4-dihydro-2H-thiochromene-7-sulfonamide (CID 4165) is 6-methyl-1,1-dioxo-3,4-dihydro-2H-thiochromene-7-sulfonamide.
What is the SMILES notation for 6-methyl-1,1-dioxo-3,4-dihydro-2H-thiochromene-7-sulfonamide?
The canonical SMILES for 6-methyl-1,1-dioxo-3,4-dihydro-2H-thiochromene-7-sulfonamide is Cc1cc2c(cc1S(N)(=O)=O)S(=O)(=O)CCC2.
What is the InChIKey of 6-methyl-1,1-dioxo-3,4-dihydro-2H-thiochromene-7-sulfonamide?
The InChIKey is FNQQBFNIYODEMB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13NO4S2/c1-7-5-8-3-2-4-16(12,13)10(8)6-9(7)17(11,14)15/h5-6H,2-4H2,1H3,(H2,11,14,15).
What are the key properties of 6-methyl-1,1-dioxo-3,4-dihydro-2H-thiochromene-7-sulfonamide?
6-methyl-1,1-dioxo-3,4-dihydro-2H-thiochromene-7-sulfonamide has a molecular weight of 275.35 g/mol, XLogP of 0.36, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methyl-1,1-dioxo-3,4-dihydro-2H-thiochromene-7-sulfonamide is sourced from PubChem (CID 4165), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).