C15H11ClN2O — CID 2997
View drug profile → nordazepam7-chloro-5-phenyl-1,3-dihydro-1,4-benzodiazepin-2-one (PubChem CID 2997) has the molecular formula C15H11ClN2O and a molecular weight of 270.72 g/mol. Its IUPAC name is 7-chloro-5-phenyl-1,3-dihydro-1,4-benzodiazepin-2-one.
| Compound Name | 7-chloro-5-phenyl-1,3-dihydro-1,4-benzodiazepin-2-one |
|---|---|
| PubChem CID | 2997 |
| Molecular Formula | C15H11ClN2O |
| Molecular Weight | 270.72 g/mol |
| Exact Mass | 270.06 |
| IUPAC Name | 7-chloro-5-phenyl-1,3-dihydro-1,4-benzodiazepin-2-one |
| SMILES | O=C1CN=C(c2ccccc2)c2cc(Cl)ccc2N1 |
| InChI | InChI=1S/C15H11ClN2O/c16-11-6-7-13-12(8-11)15(17-9-14(19)18-13)10-4-2-1-3-5-10/h1-8H,9H2,(H,18,19) |
| InChIKey | AKPLHCDWDRPJGD-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.72 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |