C17H27Cl2N5 — CID 636391
View drug profile → olanexidine1-[N'-[(3,4-dichlorophenyl)methyl]carbamimidoyl]-2-octylguanidine (PubChem CID 636391) has the molecular formula C17H27Cl2N5 and a molecular weight of 372.34 g/mol. Its IUPAC name is 1-[N'-[(3,4-dichlorophenyl)methyl]carbamimidoyl]-2-octylguanidine.
| Compound Name | 1-[N'-[(3,4-dichlorophenyl)methyl]carbamimidoyl]-2-octylguanidine |
|---|---|
| PubChem CID | 636391 |
| Molecular Formula | C17H27Cl2N5 |
| Molecular Weight | 372.34 g/mol |
| Exact Mass | 371.16 |
| IUPAC Name | 1-[N'-[(3,4-dichlorophenyl)methyl]carbamimidoyl]-2-octylguanidine |
| SMILES | CCCCCCCC/N=C(\N)N/C(N)=N/Cc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C17H27Cl2N5/c1-2-3-4-5-6-7-10-22-16(20)24-17(21)23-12-13-8-9-14(18)15(19)11-13/h8-9,11H,2-7,10,12H2,1H3,(H5,20,21,22,23,24) |
| InChIKey | ZZQMUJGZCZTLQD-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 88.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.34 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|