C9H12N4O3 — CID 1892
View drug profile → etofylline7-(2-hydroxyethyl)-1,3-dimethylpurine-2,6-dione (PubChem CID 1892) has the molecular formula C9H12N4O3 and a molecular weight of 224.22 g/mol. Its IUPAC name is 7-(2-hydroxyethyl)-1,3-dimethylpurine-2,6-dione.
| Compound Name | 7-(2-hydroxyethyl)-1,3-dimethylpurine-2,6-dione |
|---|---|
| PubChem CID | 1892 |
| Molecular Formula | C9H12N4O3 |
| Molecular Weight | 224.22 g/mol |
| Exact Mass | 224.09 |
| IUPAC Name | 7-(2-hydroxyethyl)-1,3-dimethylpurine-2,6-dione |
| SMILES | Cn1c(=O)c2c(ncn2CCO)n(C)c1=O |
| InChI | InChI=1S/C9H12N4O3/c1-11-7-6(8(15)12(2)9(11)16)13(3-4-14)5-10-7/h5,14H,3-4H2,1-2H3 |
| InChIKey | NWPRCRWQMGIBOT-UHFFFAOYSA-N |
| XLogP | -1.57 |
| TPSA | 82.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.22 |
| LogP ≤ 5 | -1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |