2-(dimethylamino)ethyl 2,2-diphenyl-2-prop-2-ynoxyacetate

C21H23NO3 — CID 17700

💊View drug profile → pargeverine
IUPAC2-(dimethylamino)ethyl 2,2-diphenyl-2-prop-2-ynoxyacetate
SMILESC#CCOC(C(=O)OCCN(C)C)(c1ccccc1)c1ccccc1
InChIInChI=1S/C21H23NO3/c1-4-16-25-21(18-11-7-5-8-12-18,19-13-9-6-10-14-19)20(23)24-17-15-22(2)3/h1,5-14H,15-17H2,2-3H3
InChIKeyQNPHCSSJLHAKSA-UHFFFAOYSA-N
MW337.42 g/mol
LogP2.68
Rot. Bonds8

About 2-(dimethylamino)ethyl 2,2-diphenyl-2-prop-2-ynoxyacetate

2-(dimethylamino)ethyl 2,2-diphenyl-2-prop-2-ynoxyacetate (PubChem CID 17700) has the molecular formula C21H23NO3 and a molecular weight of 337.42 g/mol. Its IUPAC name is 2-(dimethylamino)ethyl 2,2-diphenyl-2-prop-2-ynoxyacetate.

Molecular Properties

Compound Name2-(dimethylamino)ethyl 2,2-diphenyl-2-prop-2-ynoxyacetate
PubChem CID17700
Molecular FormulaC21H23NO3
Molecular Weight337.42 g/mol
Exact Mass337.17
IUPAC Name2-(dimethylamino)ethyl 2,2-diphenyl-2-prop-2-ynoxyacetate
SMILESC#CCOC(C(=O)OCCN(C)C)(c1ccccc1)c1ccccc1
InChIInChI=1S/C21H23NO3/c1-4-16-25-21(18-11-7-5-8-12-18,19-13-9-6-10-14-19)20(23)24-17-15-22(2)3/h1,5-14H,15-17H2,2-3H3
InChIKeyQNPHCSSJLHAKSA-UHFFFAOYSA-N
XLogP2.68
TPSA38.77 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds8
Heavy Atoms25
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500337.42
LogP ≤ 52.68
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'triple_bond', 'substructure': 'N/A'}

Analyze 2-(dimethylamino)ethyl 2,2-diphenyl-2-prop-2-ynoxyacetate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(dimethylamino)ethyl 2,2-diphenyl-2-prop-2-ynoxyacetate?
The IUPAC name of 2-(dimethylamino)ethyl 2,2-diphenyl-2-prop-2-ynoxyacetate (CID 17700) is 2-(dimethylamino)ethyl 2,2-diphenyl-2-prop-2-ynoxyacetate.
What is the SMILES notation for 2-(dimethylamino)ethyl 2,2-diphenyl-2-prop-2-ynoxyacetate?
The canonical SMILES for 2-(dimethylamino)ethyl 2,2-diphenyl-2-prop-2-ynoxyacetate is C#CCOC(C(=O)OCCN(C)C)(c1ccccc1)c1ccccc1.
What is the InChIKey of 2-(dimethylamino)ethyl 2,2-diphenyl-2-prop-2-ynoxyacetate?
The InChIKey is QNPHCSSJLHAKSA-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H23NO3/c1-4-16-25-21(18-11-7-5-8-12-18,19-13-9-6-10-14-19)20(23)24-17-15-22(2)3/h1,5-14H,15-17H2,2-3H3.
What are the key properties of 2-(dimethylamino)ethyl 2,2-diphenyl-2-prop-2-ynoxyacetate?
2-(dimethylamino)ethyl 2,2-diphenyl-2-prop-2-ynoxyacetate has a molecular weight of 337.42 g/mol, XLogP of 2.68, 8 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(dimethylamino)ethyl 2,2-diphenyl-2-prop-2-ynoxyacetate is sourced from PubChem (CID 17700), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).